Alkyl Halides
Filtered Search Results
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
1-Bromohexane, 99+%
CAS: 111-25-1 Molecular Formula: C6H13Br Molecular Weight (g/mol): 165.07 MDL Number: MFCD00000271 InChI Key: MNDIARAMWBIKFW-UHFFFAOYSA-N Synonym: hexyl bromide,n-hexyl bromide,bromohexane,1-hexyl bromide,hexane, 1-bromo,hexane, bromo,unii-wva0fax7ga,1-bromo-hexane,pentane, bromomethyl,wva0fax7ga PubChem CID: 8101 IUPAC Name: 1-bromohexane SMILES: CCCCCCBr
| PubChem CID | 8101 |
|---|---|
| CAS | 111-25-1 |
| Molecular Weight (g/mol) | 165.07 |
| MDL Number | MFCD00000271 |
| SMILES | CCCCCCBr |
| Synonym | hexyl bromide,n-hexyl bromide,bromohexane,1-hexyl bromide,hexane, 1-bromo,hexane, bromo,unii-wva0fax7ga,1-bromo-hexane,pentane, bromomethyl,wva0fax7ga |
| IUPAC Name | 1-bromohexane |
| InChI Key | MNDIARAMWBIKFW-UHFFFAOYSA-N |
| Molecular Formula | C6H13Br |
Perfluoroheptanoic acid, 98+%
CAS: 375-85-9 Molecular Formula: C7HF13O2 Molecular Weight (g/mol): 364.062 MDL Number: MFCD00039604 InChI Key: ZWBAMYVPMDSJGQ-UHFFFAOYSA-N Synonym: perfluoroheptanoic acid,tridecafluoroheptanoic acid,perfluoroenanthic acid,perfluoro-n-heptanoic acid,heptanoic acid, tridecafluoro,tridecafluoro-1-heptanoic acid,heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro,n-perfluoroheptanoic acid,tridecafluoroenanthic acid,acmc-1agq8 PubChem CID: 67818 ChEBI: CHEBI:35547 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid SMILES: C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
| PubChem CID | 67818 |
|---|---|
| CAS | 375-85-9 |
| Molecular Weight (g/mol) | 364.062 |
| ChEBI | CHEBI:35547 |
| MDL Number | MFCD00039604 |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| Synonym | perfluoroheptanoic acid,tridecafluoroheptanoic acid,perfluoroenanthic acid,perfluoro-n-heptanoic acid,heptanoic acid, tridecafluoro,tridecafluoro-1-heptanoic acid,heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro,n-perfluoroheptanoic acid,tridecafluoroenanthic acid,acmc-1agq8 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
| InChI Key | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| Molecular Formula | C7HF13O2 |
Neopentyl bromide, 98%
CAS: 630-17-1 Molecular Formula: C5H11Br Molecular Weight (g/mol): 151.05 MDL Number: MFCD00000209 InChI Key: CQWYAXCOVZKLHY-UHFFFAOYSA-N Synonym: neopentyl bromide,propane, 1-bromo-2,2-dimethyl,1-bromo-2,2-dimethyl-propane,ccris 4895,neopentylbromde,neopentylbromide,neo-pentyl bromide,ch3 3cch2br,3-bromo-2,2-dimethylpropyl,neopentyl bromide 5g PubChem CID: 12415 IUPAC Name: 1-bromo-2,2-dimethylpropane SMILES: CC(C)(C)CBr
| PubChem CID | 12415 |
|---|---|
| CAS | 630-17-1 |
| Molecular Weight (g/mol) | 151.05 |
| MDL Number | MFCD00000209 |
| SMILES | CC(C)(C)CBr |
| Synonym | neopentyl bromide,propane, 1-bromo-2,2-dimethyl,1-bromo-2,2-dimethyl-propane,ccris 4895,neopentylbromde,neopentylbromide,neo-pentyl bromide,ch3 3cch2br,3-bromo-2,2-dimethylpropyl,neopentyl bromide 5g |
| IUPAC Name | 1-bromo-2,2-dimethylpropane |
| InChI Key | CQWYAXCOVZKLHY-UHFFFAOYSA-N |
| Molecular Formula | C5H11Br |
Cyclopropyl bromide, 99%
CAS: 4333-56-6 Molecular Formula: C3H5Br Molecular Weight (g/mol): 120.98 MDL Number: MFCD00001271 InChI Key: LKXYJYDRLBPHRS-UHFFFAOYSA-N Synonym: cyclopropyl bromide,cyclopropane, bromo,cyclopropylbromide,bromo-cyclopropan,bromo-cyclopropane,cyclopropylbrornide,bromanylcyclopropane,pubchem14417,bromocyclopropane,acmc-1aii5 PubChem CID: 78037 IUPAC Name: bromocyclopropane SMILES: C1CC1Br
| PubChem CID | 78037 |
|---|---|
| CAS | 4333-56-6 |
| Molecular Weight (g/mol) | 120.98 |
| MDL Number | MFCD00001271 |
| SMILES | C1CC1Br |
| Synonym | cyclopropyl bromide,cyclopropane, bromo,cyclopropylbromide,bromo-cyclopropan,bromo-cyclopropane,cyclopropylbrornide,bromanylcyclopropane,pubchem14417,bromocyclopropane,acmc-1aii5 |
| IUPAC Name | bromocyclopropane |
| InChI Key | LKXYJYDRLBPHRS-UHFFFAOYSA-N |
| Molecular Formula | C3H5Br |
1,1,2,2-Tetrabromoethane, 97%
CAS: 79-27-6 Molecular Formula: C2H2Br4 Molecular Weight (g/mol): 345.65 MDL Number: MFCD00000133 InChI Key: QXSZNDIIPUOQMB-UHFFFAOYSA-N Synonym: acetylene tetrabromide,muthmann's liquid,ethane, 1,1,2,2-tetrabromo,tetrabromoacetylene,sym-tetrabromoethane,s-tetrabromoethane,1,1,2,2-tetrabromaethan,1,1,2,2-tetrabromoetano,tbe,unii-v00gkc584o PubChem CID: 6588 IUPAC Name: 1,1,2,2-tetrabromoethane SMILES: BrC(Br)C(Br)Br
| PubChem CID | 6588 |
|---|---|
| CAS | 79-27-6 |
| Molecular Weight (g/mol) | 345.65 |
| MDL Number | MFCD00000133 |
| SMILES | BrC(Br)C(Br)Br |
| Synonym | acetylene tetrabromide,muthmann's liquid,ethane, 1,1,2,2-tetrabromo,tetrabromoacetylene,sym-tetrabromoethane,s-tetrabromoethane,1,1,2,2-tetrabromaethan,1,1,2,2-tetrabromoetano,tbe,unii-v00gkc584o |
| IUPAC Name | 1,1,2,2-tetrabromoethane |
| InChI Key | QXSZNDIIPUOQMB-UHFFFAOYSA-N |
| Molecular Formula | C2H2Br4 |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.835 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.835 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Dichloromethane-d2, for NMR, 99.5 atom % D, AcroSeal™
CAS: 1665-00-5 Molecular Formula: CCl2D2 Molecular Weight (g/mol): 86.95 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.95 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CCl2D2 |
2-Bromo-2-methylpropane, 96%, stabilized
CAS: 507-19-7 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000125 InChI Key: RKSOPLXZQNSWAS-UHFFFAOYSA-N Synonym: tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane PubChem CID: 10485 IUPAC Name: 2-bromo-2-methylpropane SMILES: CC(C)(C)Br
| PubChem CID | 10485 |
|---|---|
| CAS | 507-19-7 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000125 |
| SMILES | CC(C)(C)Br |
| Synonym | tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane |
| IUPAC Name | 2-bromo-2-methylpropane |
| InChI Key | RKSOPLXZQNSWAS-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
1-Bromodecane, 98%
CAS: 112-29-8 Molecular Formula: C10H21Br Molecular Weight (g/mol): 221.18 MDL Number: MFCD00000221 InChI Key: MYMSJFSOOQERIO-UHFFFAOYSA-N Synonym: decyl bromide,n-decyl bromide,decane, 1-bromo,1-decyl bromide,decylbromide,bromodecane,decane, bromo,labotest-bb ltbb001164,decylmonobromide,n-decylbromide PubChem CID: 8173 IUPAC Name: 1-bromodecane SMILES: CCCCCCCCCCBr
| PubChem CID | 8173 |
|---|---|
| CAS | 112-29-8 |
| Molecular Weight (g/mol) | 221.18 |
| MDL Number | MFCD00000221 |
| SMILES | CCCCCCCCCCBr |
| Synonym | decyl bromide,n-decyl bromide,decane, 1-bromo,1-decyl bromide,decylbromide,bromodecane,decane, bromo,labotest-bb ltbb001164,decylmonobromide,n-decylbromide |
| IUPAC Name | 1-bromodecane |
| InChI Key | MYMSJFSOOQERIO-UHFFFAOYSA-N |
| Molecular Formula | C10H21Br |
2-Bromobutane 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 78-76-2 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000156 InChI Key: UPSXAPQYNGXVBF-UHFFFAOYSA-N Synonym: sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 PubChem CID: 6554 IUPAC Name: 2-bromobutane SMILES: CCC(C)Br
| PubChem CID | 6554 |
|---|---|
| CAS | 78-76-2 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000156 |
| SMILES | CCC(C)Br |
| Synonym | sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 |
| IUPAC Name | 2-bromobutane |
| InChI Key | UPSXAPQYNGXVBF-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
(1-Bromoethyl)benzene 95.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 585-71-7 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000139 InChI Key: CRRUGYDDEMGVDY-UHFFFAOYSA-N Synonym: 1-bromoethyl benzene,1-phenylethyl bromide,benzene, 1-bromoethyl,1-bromo-1-phenylethane,1-phenethyl bromide,1-phenyl-1-bromoethane,alpha-phenylethyl bromide,alpha-methylbenzyl bromide,alpha-phenethyl bromide,alpha-bromoethyl benzene PubChem CID: 11454 IUPAC Name: 1-bromoethylbenzene SMILES: CC(C1=CC=CC=C1)Br
| PubChem CID | 11454 |
|---|---|
| CAS | 585-71-7 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000139 |
| SMILES | CC(C1=CC=CC=C1)Br |
| Synonym | 1-bromoethyl benzene,1-phenylethyl bromide,benzene, 1-bromoethyl,1-bromo-1-phenylethane,1-phenethyl bromide,1-phenyl-1-bromoethane,alpha-phenylethyl bromide,alpha-methylbenzyl bromide,alpha-phenethyl bromide,alpha-bromoethyl benzene |
| IUPAC Name | 1-bromoethylbenzene |
| InChI Key | CRRUGYDDEMGVDY-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
2-Bromo-2-methylpropane 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 507-19-7 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000125 InChI Key: RKSOPLXZQNSWAS-UHFFFAOYSA-N Synonym: tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane PubChem CID: 10485 IUPAC Name: 2-bromo-2-methylpropane SMILES: CC(C)(C)Br
| PubChem CID | 10485 |
|---|---|
| CAS | 507-19-7 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000125 |
| SMILES | CC(C)(C)Br |
| Synonym | tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane |
| IUPAC Name | 2-bromo-2-methylpropane |
| InChI Key | RKSOPLXZQNSWAS-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
Pentafluoropropionic acid, 97%
CAS: 422-64-0 Molecular Formula: C3HF5O2 Molecular Weight (g/mol): 164.03 MDL Number: MFCD00004170 InChI Key: LRMSQVBRUNSOJL-UHFFFAOYSA-N Synonym: pentafluoropropionic acid,perfluoropropionic acid,pentafluoropropanoic acid,propanoic acid, pentafluoro,propionic acid, pentafluoro,2,2,3,3,3-pentafluoropropionic acid,ipc-pffa-3,perfluoropropanoic acid,propanoic acid, 2,2,3,3,3-pentafluoro,perfluoropropionicacid PubChem CID: 62356 IUPAC Name: 2,2,3,3,3-pentafluoropropanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)F
| PubChem CID | 62356 |
|---|---|
| CAS | 422-64-0 |
| Molecular Weight (g/mol) | 164.03 |
| MDL Number | MFCD00004170 |
| SMILES | OC(=O)C(F)(F)C(F)(F)F |
| Synonym | pentafluoropropionic acid,perfluoropropionic acid,pentafluoropropanoic acid,propanoic acid, pentafluoro,propionic acid, pentafluoro,2,2,3,3,3-pentafluoropropionic acid,ipc-pffa-3,perfluoropropanoic acid,propanoic acid, 2,2,3,3,3-pentafluoro,perfluoropropionicacid |
| IUPAC Name | 2,2,3,3,3-pentafluoropropanoic acid |
| InChI Key | LRMSQVBRUNSOJL-UHFFFAOYSA-N |
| Molecular Formula | C3HF5O2 |
1,3-Dibromopropane, 98%
CAS: 109-64-8 Molecular Formula: C3H6Br2 Molecular Weight (g/mol): 201.89 MDL Number: MFCD00000255 InChI Key: VEFLKXRACNJHOV-UHFFFAOYSA-N Synonym: trimethylene bromide,trimethylene dibromide,propane, 1,3-dibromo,alpha,gamma-dibromopropane,unii-yqr3048ix9,ccris 6711,.alpha.,.gamma.-dibromopropane,1,3-dibromo propane,1,3-dibromo-propane,.omega.,.omega.'-dibromopropane PubChem CID: 8001 IUPAC Name: 1,3-dibromopropane SMILES: BrCCCBr
| PubChem CID | 8001 |
|---|---|
| CAS | 109-64-8 |
| Molecular Weight (g/mol) | 201.89 |
| MDL Number | MFCD00000255 |
| SMILES | BrCCCBr |
| Synonym | trimethylene bromide,trimethylene dibromide,propane, 1,3-dibromo,alpha,gamma-dibromopropane,unii-yqr3048ix9,ccris 6711,.alpha.,.gamma.-dibromopropane,1,3-dibromo propane,1,3-dibromo-propane,.omega.,.omega.'-dibromopropane |
| IUPAC Name | 1,3-dibromopropane |
| InChI Key | VEFLKXRACNJHOV-UHFFFAOYSA-N |
| Molecular Formula | C3H6Br2 |